Products 731012-01-4
CAS 731012-01-4 is the registry number for N-(4-tert-Butylphenyl)-2-chloropropanamide. Offered by: Biosynth. Available pack sizes: 5000mg.
N-(4-tert-butylphenyl)-2-chloropropanamide (CAS 731012-01-4) is a chemical compound with the molecular formula C13H18ClNO and a molecular weight of 239.74 g/mol. IUPAC name: N-(4-tert-butylphenyl)-2-chloropropanamide. InChIKey: PCWHRWYTDPAXNZ-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO |
|---|---|
| Molecular weight | 239.74 g/mol |
| IUPAC name | N-(4-tert-butylphenyl)-2-chloropropanamide |
| InChIKey | PCWHRWYTDPAXNZ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CC=C(C=C1)C(C)(C)C)Cl |
Computed by PubChem (NCBI)