CAS 731811-50-0 appears in our catalog under these names: rac-(1R,2R)-2-(Pyridin-3-yl)cyclopropane-1-carboxylic acid, rel-(1R,2R)-2-(Pyridin-3-yl)cyclopropane-1-carboxylic acid, 98%, 98%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg.
Trans-(1R,2R)-2-pyridin-3-ylcyclopropane-1-carboxylic acid (CAS 731811-50-0) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: trans-(1R,2R)-2-pyridin-3-ylcyclopropane-1-carboxylic acid. InChIKey: RMVMPLYFCJXMCQ-JGVFFNPUSA-N.
| Molecular formula | C9H9NO2 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | trans-(1R,2R)-2-pyridin-3-ylcyclopropane-1-carboxylic acid |
| InChIKey | RMVMPLYFCJXMCQ-JGVFFNPUSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CN=CC=C2 |
Computed by PubChem (NCBI)