Products 731812-00-3
CAS 731812-00-3 appears in our catalog under these names: (2R,3R)-3-Phenylpyrrolidine-2-carboxylic acid, 95%, (2R,3R)-3-Phenylpyrrolidine-2-carboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
(2R,3R)-3-phenylpyrrolidine-2-carboxylic acid (CAS 731812-00-3) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: (2R,3R)-3-phenylpyrrolidine-2-carboxylic acid. InChIKey: VDEMEKSASUGYHM-NXEZZACHSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | (2R,3R)-3-phenylpyrrolidine-2-carboxylic acid |
| InChIKey | VDEMEKSASUGYHM-NXEZZACHSA-N |
| SMILES | C1CN[C@H]([C@H]1C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)