Products 731826-96-3

CAS 731826-96-3 is the registry number for 3-Ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)benzoic acid (CAS 731826-96-3) is a chemical compound with the molecular formula C16H21NO5 and a molecular weight of 307.34 g/mol. IUPAC name: 3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)benzoic acid. InChIKey: ZQQRFYQNXBKLEZ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H21NO5
Molecular weight307.34 g/mol
IUPAC name3-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)benzoic acid
InChIKeyZQQRFYQNXBKLEZ-UHFFFAOYSA-N
SMILESCCOC1=C(C=CC(=C1)C(=O)O)OCC(=O)N2CCCCC2

Computed by PubChem (NCBI)