CAS 73281-83-1 appears in our catalog under these names: 1,2-Dimethylquinolin-4-one-3-carboxylic acid, 1,4-Dihydro-1,2-dimethyl-4-oxo-3-quinolinecarboxylic acid. Offered by: TargetMol, Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 25mg, 10mg, 50mg, Get quote.
1,2-dimethyl-4-oxoquinoline-3-carboxylic acid (CAS 73281-83-1) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: 1,2-dimethyl-4-oxoquinoline-3-carboxylic acid. InChIKey: RDEXTEPFIVECBD-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 1,2-dimethyl-4-oxoquinoline-3-carboxylic acid |
| InChIKey | RDEXTEPFIVECBD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)C2=CC=CC=C2N1C)C(=O)O |
Computed by PubChem (NCBI)