Products 73284-94-3
CAS 73284-94-3 is the registry number for (4AS,6S,8aS)-6-hydroxy-8a-methyloctahydronaphthalen-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4aS,6S,8aS)-6-hydroxy-8a-methyl-2,3,4,4a,5,6,7,8-octahydronaphthalen-1-one (CAS 73284-94-3) is a chemical compound with the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. IUPAC name: (4aS,6S,8aS)-6-hydroxy-8a-methyl-2,3,4,4a,5,6,7,8-octahydronaphthalen-1-one. InChIKey: AQICJZJJNASFSN-QXEWZRGKSA-N.
| Molecular formula | C11H18O2 |
|---|---|
| Molecular weight | 182.26 g/mol |
| IUPAC name | (4aS,6S,8aS)-6-hydroxy-8a-methyl-2,3,4,4a,5,6,7,8-octahydronaphthalen-1-one |
| InChIKey | AQICJZJJNASFSN-QXEWZRGKSA-N |
| SMILES | C[C@]12CC[C@@H](C[C@@H]1CCCC2=O)O |
Computed by PubChem (NCBI)