Products 7329-52-4
CAS 7329-52-4 appears in our catalog under these names: 2-Methoxyphenol-3,4,5,6-d4, >95% (GC), 2-Methoxyphenol-3,4,5,6-d4, 98 atom % D, min 98% Chemical Purity, Guaiacol-d4. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 1g, 0,5g, 100 mg, 50 mg, 10 mg.
2,3,4,5-tetradeuterio-6-methoxyphenol (CAS 7329-52-4) is a chemical compound with the molecular formula C7H8O2 and a molecular weight of 128.16 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-methoxyphenol. InChIKey: LHGVFZTZFXWLCP-QFFDRWTDSA-N.
| Molecular formula | C7H8O2 |
|---|---|
| Molecular weight | 128.16 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-methoxyphenol |
| InChIKey | LHGVFZTZFXWLCP-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])O)OC)[2H])[2H] |
Computed by PubChem (NCBI)