CAS 74495-69-5 appears in our catalog under these names: 2-Methoxyphenol-d3, >95% (GC), 2-Methoxy-d3-phenol, 99 atom % D, min 98% Chemical Purity, 2–Methoxyphenol–d3, Guaiacol–d3, Guaiacol-d3, 99.0%. Offered by: TRC, CDN, GLPBio, MedChemExpress, HPC Standards. Available pack sizes: 250mg, 25mg, 1g, 0,5g, 5mg, 10mg, 100mg, 50mg.
2-(trideuteriomethoxy)phenol (CAS 74495-69-5) is a chemical compound with the molecular formula C7H8O2 and a molecular weight of 127.16 g/mol. IUPAC name: 2-(trideuteriomethoxy)phenol. InChIKey: LHGVFZTZFXWLCP-FIBGUPNXSA-N.
| Molecular formula | C7H8O2 |
|---|---|
| Molecular weight | 127.16 g/mol |
| IUPAC name | 2-(trideuteriomethoxy)phenol |
| InChIKey | LHGVFZTZFXWLCP-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC=CC=C1O |
Computed by PubChem (NCBI)