CAS 73323-91-8 appears in our catalog under these names: 2-((2R)-1-Hydroxypropan-2-yl)-2,3-dihydro-1H-isoindole-1,3-dione, (R)-2-(1-Hydroxypropan-2-Yl)Isoindoline-1,3-Dione, 98%, 98%, (R)-2-(1-Hydroxypropan-2-yl)isoindoline-1,3-dione, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g, 5g.
2-[(2R)-1-hydroxypropan-2-yl]isoindole-1,3-dione (CAS 73323-91-8) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: 2-[(2R)-1-hydroxypropan-2-yl]isoindole-1,3-dione. InChIKey: KYTIHOIDWMVRKU-SSDOTTSWSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 2-[(2R)-1-hydroxypropan-2-yl]isoindole-1,3-dione |
| InChIKey | KYTIHOIDWMVRKU-SSDOTTSWSA-N |
| SMILES | C[C@H](CO)N1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)