Products 7333-07-5
CAS 7333-07-5 appears in our catalog under these names: 2,2'-Thenil, min. 95 %, 5 g, 2,2'-Thenil, 98%, 2，2'–Thenil, 2,2'-Thenil, 98% , 2,2'-Thenil, >98.0%(GC). Offered by: Roth, Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 5g, 1g, 250mg, 100mg, 2g, 10g, 25g.
1,2-dithiophen-2-ylethane-1,2-dione (CAS 7333-07-5) is a chemical compound with the molecular formula C10H6O2S2 and a molecular weight of 222.3 g/mol. IUPAC name: 1,2-dithiophen-2-ylethane-1,2-dione. InChIKey: UNWKVSDABPCZMK-UHFFFAOYSA-N.
| Molecular formula | C10H6O2S2 |
|---|---|
| Molecular weight | 222.3 g/mol |
| IUPAC name | 1,2-dithiophen-2-ylethane-1,2-dione |
| InChIKey | UNWKVSDABPCZMK-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(=O)C(=O)C2=CC=CS2 |
Computed by PubChem (NCBI)
Synonyms:
2,2'-Thenil, 1,2-di(thiophen-2-yl)ethane-1,2-dione, 1,2-dithiophen-2-ylethane-1,2-dione, bis(thiophen-2-yl)ethane-1,2-dione, 1,2-di(2-thienyl)-1,2-ethanedione, 1,2-Di-thiophen-2-yl-ethane-1,2-dione, 1,2-di(2-thienyl)ethane-1,2-dione, 2,2 inverted exclamation marka-Thenil, Ethanedione, di-2-thienyl-, Di-2-thienylethanedione