CAS 7333-08-6 appears in our catalog under these names: 1,2-Di-3-thienyl-1,2-ethanedione, 98%, 1,2–Di(thiophen–3–yl)ethane–1,2–dione, 1,2-Di(thiophen-3-yl)ethane-1,2-dione 95%, 1,2-Di(thiophen-3-yl)ethane-1,2-dione, 98%, 98%, 1,2-DI(3-THIENYL)-1,2-ETHANEDIONE, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g.
1,2-di(thiophen-3-yl)ethane-1,2-dione (CAS 7333-08-6) is a chemical compound with the molecular formula C10H6O2S2 and a molecular weight of 222.3 g/mol. IUPAC name: 1,2-di(thiophen-3-yl)ethane-1,2-dione. InChIKey: JMJXLGSQHPIURJ-UHFFFAOYSA-N.
| Molecular formula | C10H6O2S2 |
|---|---|
| Molecular weight | 222.3 g/mol |
| IUPAC name | 1,2-di(thiophen-3-yl)ethane-1,2-dione |
| InChIKey | JMJXLGSQHPIURJ-UHFFFAOYSA-N |
| SMILES | C1=CSC=C1C(=O)C(=O)C2=CSC=C2 |
Computed by PubChem (NCBI)