CAS 73351-87-8 appears in our catalog under these names: 5,7-Dimethyl-1,3-benzothiazol-2-amine, 95%, 5,7-Dimethylbenzo(d)thiazol-2-amine, 95%, 2–Benzothiazolamine,5,7–dimethyl–(9CI). Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 250mg, 10g, 1g, 50mg.
5,7-dimethyl-1,3-benzothiazol-2-amine (CAS 73351-87-8) is a chemical compound with the molecular formula C9H10N2S and a molecular weight of 178.26 g/mol. IUPAC name: 5,7-dimethyl-1,3-benzothiazol-2-amine. InChIKey: AKPWHGBCJISNKZ-UHFFFAOYSA-N.
| Molecular formula | C9H10N2S |
|---|---|
| Molecular weight | 178.26 g/mol |
| IUPAC name | 5,7-dimethyl-1,3-benzothiazol-2-amine |
| InChIKey | AKPWHGBCJISNKZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)N=C(S2)N)C |
Computed by PubChem (NCBI)