CAS 73443-85-3 is the registry number for 4-Bromobenzo[d]thiazol-2(3H)-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
4-bromo-3H-1,3-benzothiazol-2-one (CAS 73443-85-3) is a chemical compound with the molecular formula C7H4BrNOS and a molecular weight of 230.08 g/mol. IUPAC name: 4-bromo-3H-1,3-benzothiazol-2-one. InChIKey: JOFGIHYTADMYMX-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNOS |
|---|---|
| Molecular weight | 230.08 g/mol |
| IUPAC name | 4-bromo-3H-1,3-benzothiazol-2-one |
| InChIKey | JOFGIHYTADMYMX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)NC(=O)S2 |
Computed by PubChem (NCBI)