Products 734533-08-5
CAS 734533-08-5 is the registry number for 4-(3,5-Dimethyl-1H-pyrazol-4-yl)pyridine, 98%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-(3,5-dimethyl-1H-pyrazol-4-yl)pyridine (CAS 734533-08-5) is a chemical compound with the molecular formula C10H11N3 and a molecular weight of 173.21 g/mol. IUPAC name: 4-(3,5-dimethyl-1H-pyrazol-4-yl)pyridine. InChIKey: NSEIBZSJVXVARF-UHFFFAOYSA-N.
| Molecular formula | C10H11N3 |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 4-(3,5-dimethyl-1H-pyrazol-4-yl)pyridine |
| InChIKey | NSEIBZSJVXVARF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)C2=CC=NC=C2 |
Computed by PubChem (NCBI)