CAS 73522-42-6 appears in our catalog under these names: (-)-Cis-myrtanylamine, 98%, ((1S,2R,5S)-6,6-Dimethylbicyclo(3.1.1)heptan-2-yl)methanamine, 98%, (-)-CIS-MYRTANYLAMINE, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 250mg.
[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methanamine (CAS 73522-42-6) is a chemical compound with the molecular formula C10H19N and a molecular weight of 153.26 g/mol. IUPAC name: [(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methanamine. InChIKey: SYJBFPCQIJQYNV-CIUDSAMLSA-N.
| Molecular formula | C10H19N |
|---|---|
| Molecular weight | 153.26 g/mol |
| IUPAC name | [(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methanamine |
| InChIKey | SYJBFPCQIJQYNV-CIUDSAMLSA-N |
| SMILES | CC1([C@H]2CC[C@H]([C@@H]1C2)CN)C |
Computed by PubChem (NCBI)