Products 73594-44-2
CAS 73594-44-2 is the registry number for 3,4-Di-O-benzyl DL-erythro-Droxidopa Hydrochloride. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
(2S,3S)-2-amino-3-[3,4-bis(phenylmethoxy)phenyl]-3-hydroxypropanoic acid;hydrochloride (CAS 73594-44-2) is a chemical compound with the molecular formula C23H24ClNO5 and a molecular weight of 429.9 g/mol. IUPAC name: (2S,3S)-2-amino-3-[3,4-bis(phenylmethoxy)phenyl]-3-hydroxypropanoic acid;hydrochloride. InChIKey: QRDDBOMVDDCUHX-VROPFNGYSA-N.
| Molecular formula | C23H24ClNO5 |
|---|---|
| Molecular weight | 429.9 g/mol |
| IUPAC name | (2S,3S)-2-amino-3-[3,4-bis(phenylmethoxy)phenyl]-3-hydroxypropanoic acid;hydrochloride |
| InChIKey | QRDDBOMVDDCUHX-VROPFNGYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)[C@@H]([C@@H](C(=O)O)N)O)OCC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)