Products 87293-45-6
CAS 87293-45-6 is the registry number for Indometacin 2,3-Butylene Glycol Ester. Offered by: Mikromol. Available pack sizes: 25mg.
3-hydroxybutan-2-yl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate (CAS 87293-45-6) is a chemical compound with the molecular formula C23H24ClNO5 and a molecular weight of 429.9 g/mol. IUPAC name: 3-hydroxybutan-2-yl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate. InChIKey: ZJTNVASNQTXDQP-UHFFFAOYSA-N.
| Molecular formula | C23H24ClNO5 |
|---|---|
| Molecular weight | 429.9 g/mol |
| IUPAC name | 3-hydroxybutan-2-yl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate |
| InChIKey | ZJTNVASNQTXDQP-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1C(=O)C3=CC=C(C=C3)Cl)C=CC(=C2)OC)CC(=O)OC(C)C(C)O |
Computed by PubChem (NCBI)