Products 736990-25-3
CAS 736990-25-3 is the registry number for Methyl 2-(methylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 97%, 97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
Methyl 2-(methylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 736990-25-3) is a chemical compound with the molecular formula C15H22BNO4 and a molecular weight of 291.15 g/mol. IUPAC name: methyl 2-(methylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: QCFBHUAQACJQPR-UHFFFAOYSA-N.
| Molecular formula | C15H22BNO4 |
|---|---|
| Molecular weight | 291.15 g/mol |
| IUPAC name | methyl 2-(methylamino)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | QCFBHUAQACJQPR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)NC)C(=O)OC |
Computed by PubChem (NCBI)