CAS 737000-90-7 is the registry number for (1R,2R)-(-)-2-Benzyloxycyclopentyl isothiocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
[(1R,2R)-2-isothiocyanatocyclopentyl]oxymethylbenzene (CAS 737000-90-7) is a chemical compound with the molecular formula C13H15NOS and a molecular weight of 233.33 g/mol. IUPAC name: [(1R,2R)-2-isothiocyanatocyclopentyl]oxymethylbenzene. InChIKey: XPXSISUCDSDZAB-CHWSQXEVSA-N.
| Molecular formula | C13H15NOS |
|---|---|
| Molecular weight | 233.33 g/mol |
| IUPAC name | [(1R,2R)-2-isothiocyanatocyclopentyl]oxymethylbenzene |
| InChIKey | XPXSISUCDSDZAB-CHWSQXEVSA-N |
| SMILES | C1C[C@H]([C@@H](C1)OCC2=CC=CC=C2)N=C=S |
Computed by PubChem (NCBI)