CAS 871478-75-0 appears in our catalog under these names: 3-Cyclopropyl-2-(4-methylphenyl)-1,3-thiazolidin-4-one, 95%, 3-Cyclopropyl-2-(4-methylphenyl)-1,3-thiazolidin-4-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
3-cyclopropyl-2-(4-methylphenyl)-1,3-thiazolidin-4-one (CAS 871478-75-0) is a chemical compound with the molecular formula C13H15NOS and a molecular weight of 233.33 g/mol. IUPAC name: 3-cyclopropyl-2-(4-methylphenyl)-1,3-thiazolidin-4-one. InChIKey: ODMVLVQZMXVTBG-UHFFFAOYSA-N.
| Molecular formula | C13H15NOS |
|---|---|
| Molecular weight | 233.33 g/mol |
| IUPAC name | 3-cyclopropyl-2-(4-methylphenyl)-1,3-thiazolidin-4-one |
| InChIKey | ODMVLVQZMXVTBG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2N(C(=O)CS2)C3CC3 |
Computed by PubChem (NCBI)