Products 73776-25-7
CAS 73776-25-7 appears in our catalog under these names: 2-Chloroquinoline-3-carboxylic acid, 95%, 2-Chloro-3-quinolinecarboxylic acid, 2-Chloroquinoline-3-carboxylic acid 98%, 2-Chloro-3-quinolinecarboxylic acid, 95%, 95%, 2-Chloro-3-quinolinecarboxylic acid, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g, 25g.
2-chloroquinoline-3-carboxylic acid (CAS 73776-25-7) is a chemical compound with the molecular formula C10H6ClNO2 and a molecular weight of 207.61 g/mol. IUPAC name: 2-chloroquinoline-3-carboxylic acid. InChIKey: XFSORZYTTCOBFN-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2 |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | 2-chloroquinoline-3-carboxylic acid |
| InChIKey | XFSORZYTTCOBFN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=N2)Cl)C(=O)O |
Computed by PubChem (NCBI)