CAS 737760-98-4 appears in our catalog under these names: (S)-3-(Trifluoromethyl)piperidine hydrochloride, 98+%, (S)-3-(Trifluoromethyl)piperidine hydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
(3S)-3-(trifluoromethyl)piperidine;hydrochloride (CAS 737760-98-4) is a chemical compound with the molecular formula C6H11ClF3N and a molecular weight of 189.60 g/mol. IUPAC name: (3S)-3-(trifluoromethyl)piperidine;hydrochloride. InChIKey: HMFJYLYZLJHSIF-JEDNCBNOSA-N.
| Molecular formula | C6H11ClF3N |
|---|---|
| Molecular weight | 189.60 g/mol |
| IUPAC name | (3S)-3-(trifluoromethyl)piperidine;hydrochloride |
| InChIKey | HMFJYLYZLJHSIF-JEDNCBNOSA-N |
| SMILES | C1C[C@@H](CNC1)C(F)(F)F.Cl |
Computed by PubChem (NCBI)