Products 737818-56-3
CAS 737818-56-3 appears in our catalog under these names: VEGFR2-IN-2, WAY–340935, VEGFR2-IN-2, 99.26%, 4-((4-Bromobenzyl)oxy)quinazoline, 98%. Offered by: TargetMol, GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 5 mg.
4-[(4-bromophenyl)methoxy]quinazoline (CAS 737818-56-3) is a chemical compound with the molecular formula C15H11BrN2O and a molecular weight of 315.16 g/mol. IUPAC name: 4-[(4-bromophenyl)methoxy]quinazoline. InChIKey: DADJIQURPZZXBT-UHFFFAOYSA-N.
| Molecular formula | C15H11BrN2O |
|---|---|
| Molecular weight | 315.16 g/mol |
| IUPAC name | 4-[(4-bromophenyl)methoxy]quinazoline |
| InChIKey | DADJIQURPZZXBT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC=N2)OCC3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)