Products 73831-13-7
CAS 73831-13-7 appears in our catalog under these names: 4–Cyano–3–methylbenzoic acid, 4-Cyano-3-methylbenzoic acid, 4-Cyano-3-methylbenzoic acid 95%, 4-Cyano-3-methylbenzoic acid, 95%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 100g, 25g, 5g, 0,5g, 0,25g, 1g, 2g, 10g.
4-cyano-3-methylbenzoic acid (CAS 73831-13-7) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: 4-cyano-3-methylbenzoic acid. InChIKey: LTRYUAZFLOGRLJ-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 4-cyano-3-methylbenzoic acid |
| InChIKey | LTRYUAZFLOGRLJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)O)C#N |
Computed by PubChem (NCBI)