CAS 739315-22-1 is the registry number for 4-Amino-2-chloro-N-ethylbenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-amino-2-chloro-N-ethylbenzamide (CAS 739315-22-1) is a chemical compound with the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. IUPAC name: 4-amino-2-chloro-N-ethylbenzamide. InChIKey: RMHURKMOAPIAQC-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O |
|---|---|
| Molecular weight | 198.65 g/mol |
| IUPAC name | 4-amino-2-chloro-N-ethylbenzamide |
| InChIKey | RMHURKMOAPIAQC-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C1=C(C=C(C=C1)N)Cl |
Computed by PubChem (NCBI)