CAS 739357-16-5 is the registry number for (R)-3-(2,4-Dihydroxy-3,3-dimethylbutanamido-15N)propanoic-1,2,3-13C3 acid, 98% +98%13C. Offered by: Chemat Brand. Available pack sizes: on request.
3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl](15N)amino](1,2,3-13C3)propanoic acid (CAS 739357-16-5) is a chemical compound with the molecular formula C9H17NO5 and a molecular weight of 223.21 g/mol. IUPAC name: 3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl](15N)amino](1,2,3-13C3)propanoic acid. InChIKey: GHOKWGTUZJEAQD-RVUUFHJWSA-N.
| Molecular formula | C9H17NO5 |
|---|---|
| Molecular weight | 223.21 g/mol |
| IUPAC name | 3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl](15N)amino](1,2,3-13C3)propanoic acid |
| InChIKey | GHOKWGTUZJEAQD-RVUUFHJWSA-N |
| SMILES | CC(C)(CO)[C@H](C(=O)[15NH][13CH2][13CH2][13C](=O)O)O |
Computed by PubChem (NCBI)