CAS 74048-10-5 is the registry number for 3-(2-Methyloxazol-5-yl)benzonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2-methyl-1,3-oxazol-5-yl)benzonitrile (CAS 74048-10-5) is a chemical compound with the molecular formula C11H8N2O and a molecular weight of 184.19 g/mol. IUPAC name: 3-(2-methyl-1,3-oxazol-5-yl)benzonitrile. InChIKey: RUHONOASDPNPFI-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 3-(2-methyl-1,3-oxazol-5-yl)benzonitrile |
| InChIKey | RUHONOASDPNPFI-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(O1)C2=CC=CC(=C2)C#N |
Computed by PubChem (NCBI)