CAS 7409-30-5 is the registry number for 4-Nitrobenzylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(4-nitrophenyl)methanamine (CAS 7409-30-5) is a chemical compound with the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. IUPAC name: (4-nitrophenyl)methanamine. InChIKey: ODVBBZFQPGORMJ-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O2 |
|---|---|
| Molecular weight | 152.15 g/mol |
| IUPAC name | (4-nitrophenyl)methanamine |
| InChIKey | ODVBBZFQPGORMJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)[N+](=O)[O-] |
Computed by PubChem (NCBI)