CAS 74098-29-6 is the registry number for 2-Chloro-4,5-dimethyl-6-nitrophenol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
6-chloro-3,4-dimethyl-2-nitrophenol (CAS 74098-29-6) is a chemical compound with the molecular formula C8H8ClNO3 and a molecular weight of 201.61 g/mol. IUPAC name: 6-chloro-3,4-dimethyl-2-nitrophenol. InChIKey: LMTRWXYYWXXVHD-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO3 |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | 6-chloro-3,4-dimethyl-2-nitrophenol |
| InChIKey | LMTRWXYYWXXVHD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)[N+](=O)[O-])O)Cl |
Computed by PubChem (NCBI)