CAS 741662-97-5 appears in our catalog under these names: (3S)-3,5-Diamino-5-oxopentanoic Acid, (S)-3,5-Diamino-5-oxopentanoic acid, 98%. Offered by: TRC, Chemat Brand. Available pack sizes: 50mg, on request.
(3S)-3,5-diamino-5-oxopentanoic acid (CAS 741662-97-5) is a chemical compound with the molecular formula C5H10N2O3 and a molecular weight of 146.14 g/mol. IUPAC name: (3S)-3,5-diamino-5-oxopentanoic acid. InChIKey: XOYSDPUJMJWCBH-VKHMYHEASA-N.
| Molecular formula | C5H10N2O3 |
|---|---|
| Molecular weight | 146.14 g/mol |
| IUPAC name | (3S)-3,5-diamino-5-oxopentanoic acid |
| InChIKey | XOYSDPUJMJWCBH-VKHMYHEASA-N |
| SMILES | C([C@@H](CC(=O)O)N)C(=O)N |
Computed by PubChem (NCBI)