CAS 744241-92-7 is the registry number for 2-Amino-N-(4-(difluoromethoxy)phenyl)benzamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-amino-N-[4-(difluoromethoxy)phenyl]benzamide (CAS 744241-92-7) is a chemical compound with the molecular formula C14H12F2N2O2 and a molecular weight of 278.25 g/mol. IUPAC name: 2-amino-N-[4-(difluoromethoxy)phenyl]benzamide. InChIKey: RNXAJKYJIXQVKV-UHFFFAOYSA-N.
| Molecular formula | C14H12F2N2O2 |
|---|---|
| Molecular weight | 278.25 g/mol |
| IUPAC name | 2-amino-N-[4-(difluoromethoxy)phenyl]benzamide |
| InChIKey | RNXAJKYJIXQVKV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=CC=C(C=C2)OC(F)F)N |
Computed by PubChem (NCBI)