CAS 832739-44-3 is the registry number for 2-(2,4-Difluoro-phenoxymethyl)-benzoic acid hydrazide. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-[(2,4-difluorophenoxy)methyl]benzohydrazide (CAS 832739-44-3) is a chemical compound with the molecular formula C14H12F2N2O2 and a molecular weight of 278.25 g/mol. IUPAC name: 2-[(2,4-difluorophenoxy)methyl]benzohydrazide. InChIKey: JRCPTAHJEZQXPB-UHFFFAOYSA-N.
| Molecular formula | C14H12F2N2O2 |
|---|---|
| Molecular weight | 278.25 g/mol |
| IUPAC name | 2-[(2,4-difluorophenoxy)methyl]benzohydrazide |
| InChIKey | JRCPTAHJEZQXPB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)COC2=C(C=C(C=C2)F)F)C(=O)NN |
Computed by PubChem (NCBI)