CAS 74495-73-1 is the registry number for Isovanillin-d3. Offered by: MedChemExpress. Available pack sizes: 1 mg.
3-hydroxy-4-(trideuteriomethoxy)benzaldehyde (CAS 74495-73-1) is a chemical compound with the molecular formula C8H8O3 and a molecular weight of 155.17 g/mol. IUPAC name: 3-hydroxy-4-(trideuteriomethoxy)benzaldehyde. InChIKey: JVTZFYYHCGSXJV-FIBGUPNXSA-N.
| Molecular formula | C8H8O3 |
|---|---|
| Molecular weight | 155.17 g/mol |
| IUPAC name | 3-hydroxy-4-(trideuteriomethoxy)benzaldehyde |
| InChIKey | JVTZFYYHCGSXJV-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C(C=C1)C=O)O |
Computed by PubChem (NCBI)