CAS 893746-92-4 is the registry number for 4-(3,4-Dichlorophenyl)but-3-yn-2-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3,4-dichlorophenyl)but-3-yn-2-ol (CAS 893746-92-4) is a chemical compound with the molecular formula C10H8Cl2O and a molecular weight of 215.07 g/mol. IUPAC name: 4-(3,4-dichlorophenyl)but-3-yn-2-ol. InChIKey: GSGNQJWHQDHBFE-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2O |
|---|---|
| Molecular weight | 215.07 g/mol |
| IUPAC name | 4-(3,4-dichlorophenyl)but-3-yn-2-ol |
| InChIKey | GSGNQJWHQDHBFE-UHFFFAOYSA-N |
| SMILES | CC(C#CC1=CC(=C(C=C1)Cl)Cl)O |
Computed by PubChem (NCBI)