CAS 74651-62-0 is the registry number for 5-(Chlorosulfonyl)-2,3-dimethoxybenzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-chlorosulfonyl-2,3-dimethoxybenzoic acid (CAS 74651-62-0) is a chemical compound with the molecular formula C9H9ClO6S and a molecular weight of 280.68 g/mol. IUPAC name: 5-chlorosulfonyl-2,3-dimethoxybenzoic acid. InChIKey: TWHADRKVBHEANG-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO6S |
|---|---|
| Molecular weight | 280.68 g/mol |
| IUPAC name | 5-chlorosulfonyl-2,3-dimethoxybenzoic acid |
| InChIKey | TWHADRKVBHEANG-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)C(=O)O)S(=O)(=O)Cl |
Computed by PubChem (NCBI)