CAS 874841-03-9 appears in our catalog under these names: 3-(Chlorosulfonyl)-2,6-dimethoxybenzoic acid, 95%, 3-(Chlorosulfonyl)-2,6-dimethoxybenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.
3-chlorosulfonyl-2,6-dimethoxybenzoic acid (CAS 874841-03-9) is a chemical compound with the molecular formula C9H9ClO6S and a molecular weight of 280.68 g/mol. IUPAC name: 3-chlorosulfonyl-2,6-dimethoxybenzoic acid. InChIKey: UVUSXOXTDVRWMQ-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO6S |
|---|---|
| Molecular weight | 280.68 g/mol |
| IUPAC name | 3-chlorosulfonyl-2,6-dimethoxybenzoic acid |
| InChIKey | UVUSXOXTDVRWMQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)S(=O)(=O)Cl)OC)C(=O)O |
Computed by PubChem (NCBI)