CAS 74685-16-8 is the registry number for Picenadol (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(3S,4R)-1,3-dimethyl-4-propylpiperidin-4-yl]phenol;hydrochloride (CAS 74685-16-8) is a chemical compound with the molecular formula C16H26ClNO and a molecular weight of 283.83 g/mol. IUPAC name: 3-[(3S,4R)-1,3-dimethyl-4-propylpiperidin-4-yl]phenol;hydrochloride. InChIKey: GUSQVRBQQVKTMO-OALZAMAHSA-N.
| Molecular formula | C16H26ClNO |
|---|---|
| Molecular weight | 283.83 g/mol |
| IUPAC name | 3-[(3S,4R)-1,3-dimethyl-4-propylpiperidin-4-yl]phenol;hydrochloride |
| InChIKey | GUSQVRBQQVKTMO-OALZAMAHSA-N |
| SMILES | CCC[C@]1(CCN(C[C@H]1C)C)C2=CC(=CC=C2)O.Cl |
Computed by PubChem (NCBI)