Products 74708-24-0
CAS 74708-24-0 is the registry number for 2-((1R,2S)-2-Hydroxycyclohexyl)acetonitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-[(1R,2S)-2-hydroxycyclohexyl]acetonitrile (CAS 74708-24-0) is a chemical compound with the molecular formula C8H13NO and a molecular weight of 139.19 g/mol. IUPAC name: 2-[(1R,2S)-2-hydroxycyclohexyl]acetonitrile. InChIKey: GAFNITUKNVGWAR-SFYZADRCSA-N.
| Molecular formula | C8H13NO |
|---|---|
| Molecular weight | 139.19 g/mol |
| IUPAC name | 2-[(1R,2S)-2-hydroxycyclohexyl]acetonitrile |
| InChIKey | GAFNITUKNVGWAR-SFYZADRCSA-N |
| SMILES | C1CC[C@@H]([C@H](C1)CC#N)O |
Computed by PubChem (NCBI)