CAS 74719-60-1 is the registry number for 4-(Benzyloxy)-3-methoxy-benzyl Alcohol-d2. Offered by: TRC. Available pack sizes: 500mg, 50mg.
Dideuterio-(3-methoxy-4-phenylmethoxyphenyl)methanol (CAS 74719-60-1) is a chemical compound with the molecular formula C15H16O3 and a molecular weight of 246.30 g/mol. IUPAC name: dideuterio-(3-methoxy-4-phenylmethoxyphenyl)methanol. InChIKey: PDBXFVPMVYQICB-KBMKNGFXSA-N.
| Molecular formula | C15H16O3 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | dideuterio-(3-methoxy-4-phenylmethoxyphenyl)methanol |
| InChIKey | PDBXFVPMVYQICB-KBMKNGFXSA-N |
| SMILES | [2H]C([2H])(C1=CC(=C(C=C1)OCC2=CC=CC=C2)OC)O |
Computed by PubChem (NCBI)