CAS 74719-63-4 is the registry number for 4-Amino-3-methoxybenzeneethanamine-d4. Offered by: TRC. Available pack sizes: 250mg, 25mg.
1,1,2,2-tetradeuterio-2-(3-methoxy-4-phenylmethoxyphenyl)ethanamine (CAS 74719-63-4) is a chemical compound with the molecular formula C16H19NO2 and a molecular weight of 261.35 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-2-(3-methoxy-4-phenylmethoxyphenyl)ethanamine. InChIKey: GLMWLELOJCRYRI-YQUBHJMPSA-N.
| Molecular formula | C16H19NO2 |
|---|---|
| Molecular weight | 261.35 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-2-(3-methoxy-4-phenylmethoxyphenyl)ethanamine |
| InChIKey | GLMWLELOJCRYRI-YQUBHJMPSA-N |
| SMILES | [2H]C([2H])(C1=CC(=C(C=C1)OCC2=CC=CC=C2)OC)C([2H])([2H])N |
Computed by PubChem (NCBI)