Products 7473-89-4

CAS 7473-89-4 is the registry number for N-(Cyclohexylcarbonyl)glycine ethyl ester, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-(cyclohexanecarbonylamino)acetate (CAS 7473-89-4) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: ethyl 2-(cyclohexanecarbonylamino)acetate. InChIKey: YFYAMUVKQYMPSM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H19NO3
Molecular weight213.27 g/mol
IUPAC nameethyl 2-(cyclohexanecarbonylamino)acetate
InChIKeyYFYAMUVKQYMPSM-UHFFFAOYSA-N
SMILESCCOC(=O)CNC(=O)C1CCCCC1

Computed by PubChem (NCBI)