CAS 7477-50-1 appears in our catalog under these names: 2-Bromo-1-(chloromethyl)-3,4-dimethoxybenzene, 2-Bromo-1-(chloromethyl)-3,4-dimethoxybenzene, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 2,5g, 250mg, 5g.
2-bromo-1-(chloromethyl)-3,4-dimethoxybenzene (CAS 7477-50-1) is a chemical compound with the molecular formula C9H10BrClO2 and a molecular weight of 265.53 g/mol. IUPAC name: 2-bromo-1-(chloromethyl)-3,4-dimethoxybenzene. InChIKey: CKEFWNYZWWCHCG-UHFFFAOYSA-N.
| Molecular formula | C9H10BrClO2 |
|---|---|
| Molecular weight | 265.53 g/mol |
| IUPAC name | 2-bromo-1-(chloromethyl)-3,4-dimethoxybenzene |
| InChIKey | CKEFWNYZWWCHCG-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)CCl)Br)OC |
Computed by PubChem (NCBI)