Products 7478-39-9

CAS 7478-39-9 is the registry number for Ethyl 7-oxo-1,2,3,4,4a,5,6,7-octahydronaphthalene-4a-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 7-oxo-1,2,3,4,5,6-hexahydronaphthalene-4a-carboxylate (CAS 7478-39-9) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. IUPAC name: ethyl 7-oxo-1,2,3,4,5,6-hexahydronaphthalene-4a-carboxylate. InChIKey: SRDFWBNFGXTHOY-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18O3
Molecular weight222.28 g/mol
IUPAC nameethyl 7-oxo-1,2,3,4,5,6-hexahydronaphthalene-4a-carboxylate
InChIKeySRDFWBNFGXTHOY-UHFFFAOYSA-N
SMILESCCOC(=O)C12CCCCC1=CC(=O)CC2

Computed by PubChem (NCBI)