CAS 291780-57-9 is the registry number for 2-((2,4-Dimethyl-3,5-dioxo-2,3,4,5-tetrahydro-1,2,4-triazin-6-yl)sulfanyl)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)sulfanyl]acetic acid (CAS 291780-57-9) is a chemical compound with the molecular formula C7H9N3O4S and a molecular weight of 231.23 g/mol. IUPAC name: 2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)sulfanyl]acetic acid. InChIKey: PEQFARLCQPNYLS-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O4S |
|---|---|
| Molecular weight | 231.23 g/mol |
| IUPAC name | 2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)sulfanyl]acetic acid |
| InChIKey | PEQFARLCQPNYLS-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=NN(C1=O)C)SCC(=O)O |
Computed by PubChem (NCBI)