CAS 748129-66-0 is the registry number for 2-Bromo-1-(5,6-dichloropyridin-3-yl)ethan-1-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-bromo-1-(5,6-dichloro-3-pyridinyl)ethanone (CAS 748129-66-0) is a chemical compound with the molecular formula C7H4BrCl2NO and a molecular weight of 268.92 g/mol. IUPAC name: 2-bromo-1-(5,6-dichloro-3-pyridinyl)ethanone. InChIKey: KJVLJNJDAHBMGP-UHFFFAOYSA-N.
| Molecular formula | C7H4BrCl2NO |
|---|---|
| Molecular weight | 268.92 g/mol |
| IUPAC name | 2-bromo-1-(5,6-dichloro-3-pyridinyl)ethanone |
| InChIKey | KJVLJNJDAHBMGP-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)Cl)C(=O)CBr |
Computed by PubChem (NCBI)