CAS 87437-41-0 is the registry number for 2-Bromo-1-(3,5-dichloropyridin-2-yl)ethanone, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-1-(3,5-dichloro-2-pyridinyl)ethanone (CAS 87437-41-0) is a chemical compound with the molecular formula C7H4BrCl2NO and a molecular weight of 268.92 g/mol. IUPAC name: 2-bromo-1-(3,5-dichloro-2-pyridinyl)ethanone. InChIKey: MNFWXYZAQPBKSQ-UHFFFAOYSA-N.
| Molecular formula | C7H4BrCl2NO |
|---|---|
| Molecular weight | 268.92 g/mol |
| IUPAC name | 2-bromo-1-(3,5-dichloro-2-pyridinyl)ethanone |
| InChIKey | MNFWXYZAQPBKSQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)C(=O)CBr)Cl |
Computed by PubChem (NCBI)