CAS 7486-93-3 appears in our catalog under these names: 3,3-Dimethyl-4-phenylazetidin-2-one, 98%, 3,3-Dimethyl-4-phenylazetidin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
3,3-dimethyl-4-phenylazetidin-2-one (CAS 7486-93-3) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 3,3-dimethyl-4-phenylazetidin-2-one. InChIKey: BURORIWFPNUAHC-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 3,3-dimethyl-4-phenylazetidin-2-one |
| InChIKey | BURORIWFPNUAHC-UHFFFAOYSA-N |
| SMILES | CC1(C(NC1=O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)