CAS 74866-25-4 is the registry number for 4,4'-Dibromo-3,3'-dimethyl-1,1'-binaphthalene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-4-(4-bromo-3-methylnaphthalen-1-yl)-2-methylnaphthalene (CAS 74866-25-4) is a chemical compound with the molecular formula C22H16Br2 and a molecular weight of 440.2 g/mol. IUPAC name: 1-bromo-4-(4-bromo-3-methylnaphthalen-1-yl)-2-methylnaphthalene. InChIKey: HUNFTPAFQJNRAT-UHFFFAOYSA-N.
| Molecular formula | C22H16Br2 |
|---|---|
| Molecular weight | 440.2 g/mol |
| IUPAC name | 1-bromo-4-(4-bromo-3-methylnaphthalen-1-yl)-2-methylnaphthalene |
| InChIKey | HUNFTPAFQJNRAT-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2C(=C1)C3=CC(=C(C4=CC=CC=C43)Br)C)Br |
Computed by PubChem (NCBI)