CAS 86631-56-3 appears in our catalog under these names: (R)–2,2''–Bis(bromomethyl)–1,1''–binaphthalene, (R)-2,2'-BIS(BROMOMETHYL)-1,1'-BINAPHTHALENE, 97%. Offered by: GLPBio, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 10g.
2-(bromomethyl)-1-[2-(bromomethyl)naphthalen-1-yl]naphthalene (CAS 86631-56-3) is a chemical compound with the molecular formula C22H16Br2 and a molecular weight of 440.2 g/mol. IUPAC name: 2-(bromomethyl)-1-[2-(bromomethyl)naphthalen-1-yl]naphthalene. InChIKey: VUUUEDHFRJQSSY-UHFFFAOYSA-N.
| Molecular formula | C22H16Br2 |
|---|---|
| Molecular weight | 440.2 g/mol |
| IUPAC name | 2-(bromomethyl)-1-[2-(bromomethyl)naphthalen-1-yl]naphthalene |
| InChIKey | VUUUEDHFRJQSSY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)CBr)CBr |
Computed by PubChem (NCBI)