CAS 74874-06-9 is the registry number for rel-(2R,4R)-4-Methylpiperidine-2-carboxylic acid, 98%. Offered by: AmBeed. Available pack sizes: 1g.
(2R,4R)-4-methylpiperidine-2-carboxylic acid (CAS 74874-06-9) is a chemical compound with the molecular formula C7H13NO2 and a molecular weight of 143.18 g/mol. IUPAC name: (2R,4R)-4-methylpiperidine-2-carboxylic acid. InChIKey: UQHCHLWYGMSPJC-PHDIDXHHSA-N.
| Molecular formula | C7H13NO2 |
|---|---|
| Molecular weight | 143.18 g/mol |
| IUPAC name | (2R,4R)-4-methylpiperidine-2-carboxylic acid |
| InChIKey | UQHCHLWYGMSPJC-PHDIDXHHSA-N |
| SMILES | C[C@@H]1CCN[C@H](C1)C(=O)O |
Computed by PubChem (NCBI)